Untitled
raw download clone
TEXT
views 14
,
size 64998 b
return(function(IIlllIlIllIIllIl,IlllIIlI,llIIIIIlIIIIIlII)local lllIIlllIIIlllI=string.char;local IIIIlllll=string.sub;local IIlllIIllIIllllIIlIIl=table.concat;local IlIllllIlIIIIlllllIIIl=math.ldexp;local lIllllllIIIIIIIlll=getfenv or function()return _ENV end;local llIIlllIlIlIIIIlI=select;local lllIlIllIIIIllIllIlIll=unpack or table.unpack;local IlllIIlI=tonumber;local lIlIlllIIIlIIIIlIII='\227\219\219\219\217\211\219\219\219\146\181\168\175\186\181\184\190\217\216\219\219\219\181\190\172\217\210\219\219\219\136\184\169\190\190\181\156\174\178\217\222\219\219\219\157\169\186\182\190\217\220\219\219\219\143\190\163\175\153\180\163\217\209\219\219\219\143\190\163\175\153\174\175\175\180\181\217\221\219\219\219\139\186\169\190\181\175\217\223\219\219\219\188\186\182\190\217\220\219\219\219\139\183\186\162\190\169\168\217\208\219\219\219\151\180\184\186\183\139\183\186\162\190\169\217\215\219\219\219\140\186\178\175\157\180\169\152\179\178\183\191\217\210\219\219\219\139\183\186\162\190\169\156\174\178\217\213\219\219\219\129\146\181\191\190\163\153\190\179\186\173\178\180\169\217\223\219\219\219\158\181\174\182\217\220\219\219\219\136\178\185\183\178\181\188\217\203\219\219\219\153\186\184\176\188\169\180\174\181\191\152\180\183\180\169\232\217\221\219\219\219\152\180\183\180\169\232\217\220\219\219\219\189\169\180\182\137\156\153\216\219\219\219\219\219\59\180\155\217\211\219\219\219\139\180\168\178\175\178\180\181\217\222\219\219\219\142\159\178\182\233\216\165\250\205\155\187\38\127\228\216\219\219\219\219\219\219\219\219\216\250\126\151\219\224\159\113\228\217\223\219\219\219\136\178\161\190\216\219\219\219\219\219\27\180\155\216\219\219\219\219\219\251\191\155\217\221\219\219\219\154\184\175\178\173\190\219\218\217\210\219\219\219\159\169\186\188\188\186\185\183\190\217\212\219\219\219\153\180\169\191\190\169\136\178\161\190\139\178\163\190\183\216\209\168\99\4\183\237\96\228\216\236\89\31\5\1\174\96\228\216\219\219\219\219\219\219\178\155\216\219\219\219\219\219\219\146\155\217\223\219\219\219\157\180\181\175\217\209\219\219\219\136\180\174\169\184\190\136\186\181\168\217\212\219\219\219\139\183\186\184\190\179\180\183\191\190\169\143\190\163\175\217\207\219\219\219\143\162\171\190\251\179\190\169\190\251\162\180\174\169\251\168\171\190\190\191\217\223\219\219\219\143\190\163\175\217\219\219\219\219\217\209\219\219\219\143\190\163\175\152\180\183\180\169\232\217\209\219\219\219\143\190\163\175\136\184\186\183\190\191\217\211\219\219\219\143\190\163\175\136\178\161\190\216\219\219\219\219\219\219\247\155\217\208\219\219\219\143\190\163\175\140\169\186\171\171\190\191\216\219\219\219\219\219\219\207\155\216\233\244\195\155\197\3\58\228\217\210\219\219\219\136\190\175\251\136\171\190\190\191\217\202\219\219\219\150\180\174\168\190\153\174\175\175\180\181\234\152\183\178\184\176\217\220\219\219\219\152\180\181\181\190\184\175\217\220\219\219\219\144\190\162\152\180\191\190\217\218\219\219\219\142\217\209\219\219\219\156\190\175\136\190\169\173\178\184\190\217\203\219\219\219\142\168\190\169\146\181\171\174\175\136\190\169\173\178\184\190\217\209\219\219\219\146\181\171\174\175\153\190\188\186\181\69\219\219\219\216\219\219\219\216\219\219\219\216\219\219\219\216\219\219\219\223\219\219\219\223\219\219\219\223\219\219\219\223\219\219\219\222\219\219\219\222\219\219\219\222\219\219\219\222\219\219\219\221\219\219\219\221\219\219\219\221\219\219\219\221\219\219\219\209\219\219\219\209\219\219\219\209\219\219\219\209\219\219\219\209\219\219\219\209\219\219\219\209\219\219\219\208\219\219\219\208\219\219\219\208\219\219\219\208\219\219\219\214\219\219\219\213\219\219\219\213\219\219\219\213\219\219\219\213\219\219\219\213\219\219\219\213\219\219\219\213\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\212\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\203\219\219\219\202\219\219\219\201\219\219\219\207\219\219\219\206\219\219\219\206\219\219\219\206\219\219\219\206\219\219\219\206\219\219\219\206\219\219\219\206\219\219\219\205\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\204\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\195\219\219\219\194\219\219\219\194\219\219\219\194\219\219\219\194\219\219\219\193\219\219\219\192\219\219\219\199\219\219\219\199\219\219\219\199\219\219\219\199\219\219\219\199\219\219\219\199\219\219\219\199\219\219\219\198\219\219\219\197\219\219\219\196\219\219\219\250\219\219\219\249\219\219\219\249\219\219\219\249\219\219\219\249\219\219\219\249\219\219\219\249\219\219\219\249\219\219\219\248\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\255\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\254\219\219\219\253\219\219\219\253\219\219\219\253\219\219\219\253\219\219\219\252\219\219\219\243\219\219\219\243\219\219\219\243\219\219\219\243\219\219\219\243\219\219\219\243\219\219\219\243\219\219\219\242\219\219\219\241\219\219\219\240\219\219\219\246\219\219\219\246\219\219\219\230\219\219\219\230\219\219\219\246\219\219\219\228\219\219\219\228\219\219\219\228\219\219\219\155\219\219\219\155\219\219\219\155\219\219\219\155\219\219\219\154\219\219\219\154\219\219\219\154\219\219\219\154\219\219\219\154\219\219\219\153\219\219\219\153\219\219\219\157\219\219\219\157\219\219\219\157\219\219\219\153\219\219\219\157\219\219\219\217\219\219\219\201\219\219\219\217\211\219\219\219\175\180\181\174\182\185\190\169\217\223\219\219\219\143\190\163\175\217\219\219\219\219\217\223\219\219\219\188\186\182\190\217\209\219\219\219\136\175\186\169\175\190\169\156\174\178\217\220\219\219\219\136\190\175\152\180\169\190\217\203\219\219\219\136\190\181\191\149\180\175\178\189\178\184\186\175\178\180\181\217\222\219\219\219\143\178\175\183\190\217\208\219\219\219\136\171\183\180\178\175\168\153\180\175\168\217\242\219\219\219\130\180\174\251\181\190\190\191\251\175\180\251\175\162\171\190\251\179\180\172\251\162\180\174\251\172\186\181\175\251\175\180\251\185\190\251\189\186\168\175\250\217\211\219\219\219\159\174\169\186\175\178\180\181\216\219\219\219\219\219\219\207\155\217\220\219\219\219\139\183\186\162\190\169\168\217\208\219\219\219\151\180\184\186\183\139\183\186\162\190\169\217\210\219\219\219\152\179\186\169\186\184\175\190\169\217\211\219\219\219\147\174\182\186\181\180\178\191\217\210\219\219\219\140\186\183\176\136\171\190\190\191\217\248\219\219\219\130\180\174\169\251\172\186\183\176\168\171\190\190\191\251\179\186\168\251\185\190\190\181\251\184\179\186\181\188\190\191\251\175\180\251\245\219\219\219\245\219\219\219\245\219\219\219\245\219\219\219\245\219\219\219\244\219\219\219\244\219\219\219\244\219\219\219\244\219\219\219\244\219\219\219\244\219\219\219\235\219\219\219\235\219\219\219\235\219\219\219\235\219\219\219\235\219\219\219\234\219\219\219\233\219\219\219\232\219\219\219\235\219\219\219\239\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\237\219\219\219\236\219\219\219\236\219\219\219\236\219\219\219\236\219\219\219\236\219\219\219\227\219\219\219\226\219\219\219\226\219\219\219\226\219\219\219\226\219\219\219\226\219\219\219\226\219\219\219\226\219\219\219\225\219\219\219\236\219\219\219\230\219\219\219\219\219\219\219\219\245\219\219\219\201\198\219\219\219\218\219\219\219\219\219\219\218\219\219\219\219\219\251\219\219\218\219\218\219\217\219\219\219\219\219\219\217\219\217\219\219\219\219\218\219\219\219\219\219\251\219\219\218\219\218\219\217\219\253\219\219\218\219\209\219\218\219\216\219\223\242\219\219\219\209\219\218\219\221\192\219\219\219\207\219\218\219\218\219\223\242\219\219\219\207\219\218\219\201\252\219\218\219\223\219\219\219\251\211\219\218\219\218\219\222\219\251\219\219\218\219\218\219\221\219\201\219\219\216\219\220\219\219\219\219\219\219\223\219\219\219\216\219\235\219\219\223\219\211\219\210\219\235\219\219\223\219\217\219\209\219\235\219\219\223\219\208\219\215\219\219\219\219\218\219\223\219\218\219\223\219\219\219\219\246\219\218\219\201\252\219\218\219\223\219\219\219\251\208\219\218\219\218\219\214\219\251\219\219\218\219\218\219\213\219\251\219\219\218\219\218\219\212\219\251\219\219\218\219\218\219\203\219\201\219\219\217\219\218\219\219\219\219\219\219\216\219\219\219\219\219\251\219\219\216\219\216\219\217\219\219\219\219\217\219\217\219\217\219\203\219\219\218\219\202\219\217\219\201\219\219\218\219\223\219\219\219\251\219\219\218\219\218\219\222\219\251\219\219\218\219\218\219\221\219\201\219\219\216\219\220\219\219\219\219\219\219\223\219\219\219\216\219\235\219\219\223\219\211\219\210\219\201\219\219\222\219\201\219\219\219\201\219\219\221\219\218\219\219\219\219\219\219\220\219\219\219\219\219\251\219\219\220\219\220\219\217\219\219\219\219\221\219\217\219\217\219\219\219\219\222\219\222\219\221\219\203\219\219\223\219\217\219\222\219\235\219\219\223\219\208\219\215\219\219\219\219\218\219\223\219\218\219\219\205\219\219\219\218\219\219\219\217\219\219\219\217\220\219\219\219\144\190\162\152\180\191\190\217\220\219\219\219\141\178\168\178\185\183\190\209\219\219\219\152\219\219\219\152\219\219\219\152\219\219\219\152\219\219\219\159\219\219\219\159\219\219\219\159\219\219\219\159\219\219\219\159\219\219\219\157\219\219\219\219\219\219\219\217\209\219\219\219\251\245\219\217\219\219\219\218\219\219\253\219\216\219\219\219\219\219\221\222\219\217\219\210\219\218\219\216\219\223\242\219\219\219\210\219\218\219\219\253\219\217\219\218\219\219\219\219\253\219\216\219\218\219\219\219\251\245\219\216\219\216\219\217\219\219\240\219\216\219\216\219\219\219\203\219\219\217\219\217\219\216\219\219\205\219\219\219\218\219\219\219\219\69\219\219\219\201\254\219\219\219\218\219\219\219\251\219\219\219\219\219\219\217\219\201\219\219\218\219\216\219\219\219\219\219\219\219\219\217\219\217\219\201\219\219\218\219\218\219\219\219\251\219\219\218\219\218\219\217\219\201\219\219\217\219\223\219\219\219\219\219\219\218\219\217\219\217\219\201\219\219\217\219\218\219\219\219\251\219\219\217\219\217\219\217\219\201\219\219\216\219\222\219\219\219\219\219\219\217\219\217\219\217\219\201\219\219\216\219\218\219\219\219\251\219\219\216\219\216\219\217\219\201\219\219\223\219\221\219\219\219\219\219\219\216\219\217\219\217\219\201\219\219\223\219\211\219\219\219\251\219\219\223\219\223\219\210\219\251\219\219\223\219\223\219\209\219\251\219\219\223\219\223\219\208\219\201\219\219\221\219\215\219\219\219\219\219\219\223\219\221\219\217\219\203\219\219\219\219\220\219\223\219\201\219\219\223\219\213\219\219\219\251\219\219\223\219\223\219\214\219\251\219\219\223\219\223\219\212\219\203\219\219\219\219\214\219\223\219\203\219\219\218\219\220\219\219\219\201\219\219\223\219\202\219\219\219\251\219\219\223\219\223\219\201\219\201\219\219\222\219\200\219\219\219\201\219\219\221\219\200\219\219\219\201\219\219\220\219\200\219\219\219\219\219\219\223\219\220\219\217\219\203\219\219\218\219\203\219\223\219\201\219\219\223\219\206\219\219\219\251\219\219\223\219\223\219\217\219\201\219\219\222\219\205\219\219\219\201\219\219\221\219\204\219\219\219\201\219\219\220\219\195\219\219\219\201\219\219\211\219\204\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\218\219\207\219\223\219\201\219\219\223\219\206\219\219\219\251\219\219\223\219\223\219\217\219\201\219\219\222\219\204\219\219\219\201\219\219\221\219\193\219\219\219\201\219\219\220\219\204\219\219\219\201\219\219\211\219\192\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\218\219\194\219\223\219\235\219\219\218\219\199\219\198\219\235\219\219\218\219\197\219\198\219\203\219\219\217\219\220\219\218\219\201\219\219\223\219\202\219\219\219\251\219\219\223\219\223\219\201\219\201\219\219\222\219\200\219\219\219\201\219\219\221\219\200\219\219\219\201\219\219\220\219\200\219\219\219\219\219\219\223\219\220\219\217\219\203\219\219\217\219\203\219\223\219\235\219\219\217\219\196\219\204\219\201\219\219\223\219\206\219\219\219\251\219\219\223\219\223\219\217\219\201\219\219\222\219\251\219\219\219\201\219\219\221\219\204\219\219\219\201\219\219\220\219\250\219\219\219\201\219\219\211\219\204\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\217\219\207\219\223\219\201\219\219\223\219\206\219\219\219\251\219\219\223\219\223\219\217\219\201\219\219\222\219\204\219\219\219\201\219\219\221\219\249\219\219\219\201\219\219\220\219\204\219\219\219\201\219\219\211\219\248\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\217\219\194\219\223\219\201\219\219\223\219\213\219\219\219\251\219\219\223\219\223\219\255\219\251\195\219\223\219\223\219\254\219\203\219\219\217\219\255\219\223\219\235\219\219\217\219\253\219\252\219\235\219\219\217\219\243\219\242\219\201\219\219\223\219\202\219\219\219\251\219\219\223\219\223\219\201\219\201\219\219\222\219\204\219\219\219\201\219\219\221\219\204\219\219\219\201\219\219\220\219\204\219\219\219\219\219\219\223\219\220\219\217\219\203\219\219\217\219\241\219\223\219\235\203\219\217\219\240\219\198\219\235\219\219\217\219\247\219\246\219\235\219\219\217\219\245\219\198\219\203\219\219\216\219\220\219\218\219\201\219\219\223\219\202\219\219\219\251\219\219\223\219\223\219\201\219\201\219\219\222\219\200\219\219\219\201\219\219\221\219\200\219\219\219\201\219\219\220\219\200\219\219\219\219\219\219\223\219\220\219\217\219\203\219\219\216\219\203\219\223\219\235\209\219\216\219\196\219\244\219\201\219\219\223\219\206\219\219\219\251\219\219\223\219\223\219\217\219\201\219\219\222\219\251\219\219\219\201\219\219\221\219\204\219\219\219\201\219\219\220\219\235\219\219\219\201\219\219\211\219\204\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\216\219\207\219\223\219\201\219\219\223\219\206\219\219\219\251\245\219\223\219\223\219\217\219\201\196\219\222\219\204\219\219\219\201\219\219\221\219\249\219\219\219\201\219\219\220\219\204\219\219\219\201\219\219\211\219\248\219\219\219\219\219\219\223\219\211\219\217\219\203\219\219\216\219\194\219\223\219\201\219\219\223\219\213\219\219\219\251\219\219\223\219\223\219\255\219\251\219\219\223\219\223\219\254\219\203\219\219\216\219\255\219\223\219\235\246\219\216\219\243\219\234\219\201\223\219\223\219\202\219\219\219\251\219\219\223\219\223\219\201\219\201\219\219\222\219\204\219\219\219\201\219\219\221\219\204\219\219\219\201\219\219\220\219\204\219\219\219\219\219\219\223\219\220\219\217\219\203\219\219\216\219\241\219\223\219\235\219\219\216\219\240\219\198\219\235\219\219\216\219\247\219\246\219\235\219\219\216\219\245\219\198\219\251\245\219\223\219\216\219\233\219\251\215\219\223\219\223\219\232\219\221\202\219\221\219\219\219\218\219\218\219\219\243\219\219\219\217\219\219\219\219\201\219\223\219\221\219\218\219\201\219\219\223\219\213\219\219\219\251\219\219\223\219\223\219\239\219\251\219\219\223\219\223\219\238\219\201\219\219\222\219\211\219\219\219\251\219\219\222\219\222\219\237\219\201\219\219\220\219\236\219\219\219\219\219\219\222\219\220\219\217\219\201\219\219\221\219\211\219\219\219\251\219\219\221\219\221\219\237\219\201\218\219\211\219\210\219\219\219\219\204\219\221\219\211\219\217\219\251\245\219\221\219\221\219\209\219\251\245\219\220\219\222\219\227\219\251\215\219\220\219\220\219\232\219\221\202\219\210\219\218\219\218\219\217\219\219\243\219\219\219\223\219\219\219\219\243\219\219\219\218\219\219\219\219\235\219\220\219\210\219\218\219\219\205\219\219\219\218\219\219\219';local IlllIIlI=(bit or bit32);local IIlIlIlIllllIIlIlI=IlllIIlI and IlllIIlI.bxor or function(IlllIIlI,IlIIIlIllIl)local lIllIlIllIlllll,IIlIlIlIllllIIlIlI,IlllIIIIIIlIIIll=1,0,10 while IlllIIlI>0 and IlIIIlIllIl>0 do local IlllIIIIIIlIIIll,IIlllIlIllIIllIl=IlllIIlI%2,IlIIIlIllIl%2 if IlllIIIIIIlIIIll~=IIlllIlIllIIllIl then IIlIlIlIllllIIlIlI=IIlIlIlIllllIIlIlI+lIllIlIllIlllll end IlllIIlI,IlIIIlIllIl,lIllIlIllIlllll=(IlllIIlI-IlllIIIIIIlIIIll)/2,(IlIIIlIllIl-IIlllIlIllIIllIl)/2,lIllIlIllIlllll*2 end if IlllIIlI<IlIIIlIllIl then IlllIIlI=IlIIIlIllIl end while IlllIIlI>0 do local IlIIIlIllIl=IlllIIlI%2 if IlIIIlIllIl>0 then IIlIlIlIllllIIlIlI=IIlIlIlIllllIIlIlI+lIllIlIllIlllll end IlllIIlI,lIllIlIllIlllll=(IlllIIlI-IlIIIlIllIl)/2,lIllIlIllIlllll*2 end return IIlIlIlIllllIIlIlI end local function IlIIIlIllIl(lIllIlIllIlllll,IlllIIlI,IlIIIlIllIl)if IlIIIlIllIl then local IlllIIlI=(lIllIlIllIlllll/2^(IlllIIlI-1))%2^((IlIIIlIllIl-1)-(IlllIIlI-1)+1);return IlllIIlI-IlllIIlI%1;else local IlllIIlI=2^(IlllIIlI-1);return(lIllIlIllIlllll%(IlllIIlI+IlllIIlI)>=IlllIIlI)and 1 or 0;end;end;local IlllIIlI=1;local function lIllIlIllIlllll()local lIllIlIllIlllll,IlIIIlIllIl,IIlllIlIllIIllIl,IlllIIIIIIlIIIll=IIlllIlIllIIllIl(lIlIlllIIIlIIIIlIII,IlllIIlI,IlllIIlI+3);lIllIlIllIlllll=IIlIlIlIllllIIlIlI(lIllIlIllIlllll,219)IlIIIlIllIl=IIlIlIlIllllIIlIlI(IlIIIlIllIl,219)IIlllIlIllIIllIl=IIlIlIlIllllIIlIlI(IIlllIlIllIIllIl,219)IlllIIIIIIlIIIll=IIlIlIlIllllIIlIlI(IlllIIIIIIlIIIll,219)IlllIIlI=IlllIIlI+4;return(IlllIIIIIIlIIIll*16777216)+(IIlllIlIllIIllIl*65536)+(IlIIIlIllIl*256)+lIllIlIllIlllll;end;local function IlIllIIllllIIIlllIlllIl()local lIllIlIllIlllll=IIlIlIlIllllIIlIlI(IIlllIlIllIIllIl(lIlIlllIIIlIIIIlIII,IlllIIlI,IlllIIlI),219);IlllIIlI=IlllIIlI+1;return lIllIlIllIlllll;end;local function IlllIIIIIIlIIIll()local lIllIlIllIlllll,IlIIIlIllIl=IIlllIlIllIIllIl(lIlIlllIIIlIIIIlIII,IlllIIlI,IlllIIlI+2);lIllIlIllIlllll=IIlIlIlIllllIIlIlI(lIllIlIllIlllll,219)IlIIIlIllIl=IIlIlIlIllllIIlIlI(IlIIIlIllIl,219)IlllIIlI=IlllIIlI+2;return(IlIIIlIllIl*256)+lIllIlIllIlllll;end;local function lIlIlIlIlllIIllIIIIlI()local IIlIlIlIllllIIlIlI=lIllIlIllIlllll();local IlllIIlI=lIllIlIllIlllll();local IlllIIIIIIlIIIll=1;local IIlIlIlIllllIIlIlI=(IlIIIlIllIl(IlllIIlI,1,20)*(2^32))+IIlIlIlIllllIIlIlI;local lIllIlIllIlllll=IlIIIlIllIl(IlllIIlI,21,31);local IlllIIlI=((-1)^IlIIIlIllIl(IlllIIlI,32));if(lIllIlIllIlllll==0)then if(IIlIlIlIllllIIlIlI==0)then return IlllIIlI*0;else lIllIlIllIlllll=1;IlllIIIIIIlIIIll=0;end;elseif(lIllIlIllIlllll==2047)then return(IIlIlIlIllllIIlIlI==0)and(IlllIIlI*(1/0))or(IlllIIlI*(0/0));end;return IlIllllIlIIIIlllllIIIl(IlllIIlI,lIllIlIllIlllll-1023)*(IlllIIIIIIlIIIll+(IIlIlIlIllllIIlIlI/(2^52)));end;local lIlIlIllIlIlIll=lIllIlIllIlllll;local function IlIllllIlIIIIlllllIIIl(lIllIlIllIlllll)local IlIIIlIllIl;if(not lIllIlIllIlllll)then lIllIlIllIlllll=lIlIlIllIlIlIll();if(lIllIlIllIlllll==0)then return'';end;end;IlIIIlIllIl=IIIIlllll(lIlIlllIIIlIIIIlIII,IlllIIlI,IlllIIlI+lIllIlIllIlllll-1);IlllIIlI=IlllIIlI+lIllIlIllIlllll;local lIllIlIllIlllll={}for IlllIIlI=1,#IlIIIlIllIl do lIllIlIllIlllll[IlllIIlI]=lllIIlllIIIlllI(IIlIlIlIllllIIlIlI(IIlllIlIllIIllIl(IIIIlllll(IlIIIlIllIl,IlllIIlI,IlllIIlI)),219))end return IIlllIIllIIllllIIlIIl(lIllIlIllIlllll);end;local IlllIIlI=lIllIlIllIlllll;local function IIlllIIllIIllllIIlIIl(...)return{...},llIIlllIlIlIIIIlI('#',...)end local function lllIIlllIIIlllI()local llIIlllIlIlIIIIlI={};local IIlIlIlIllllIIlIlI={};local lllIlIllIIIIllIllIlIll={};local lIlIlllIIIlIIIIlIII={[#{"1 + 1 = 111";{355;773;839;741};}]=IIlIlIlIllllIIlIlI,[#{"1 + 1 = 111";{935;246;384;724};"1 + 1 = 111";}]=nil,[#{{482;981;912;59};{200;117;889;70};{90;653;772;750};{878;793;841;386};}]=lllIlIllIIIIllIllIlIll,[#{"1 + 1 = 111";}]=llIIlllIlIlIIIIlI,};local IlllIIlI=lIllIlIllIlllll()local IIlllIlIllIIllIl={}for IlIIIlIllIl=1,IlllIIlI do local lIllIlIllIlllll=IlIllIIllllIIIlllIlllIl();local IlllIIlI;if(lIllIlIllIlllll==0)then IlllIIlI=(IlIllIIllllIIIlllIlllIl()~=0);elseif(lIllIlIllIlllll==3)then IlllIIlI=lIlIlIlIlllIIllIIIIlI();elseif(lIllIlIllIlllll==2)then IlllIIlI=IlIllllIlIIIIlllllIIIl();end;IIlllIlIllIIllIl[IlIIIlIllIl]=IlllIIlI;end;for IlllIIlI=1,lIllIlIllIlllll()do lllIlIllIIIIllIllIlIll[IlllIIlI]=lIllIlIllIlllll();end;for IlllIIlI=1,lIllIlIllIlllll()do IIlIlIlIllllIIlIlI[IlllIIlI-1]=lllIIlllIIIlllI();end;lIlIlllIIIlIIIIlIII[3]=IlIllIIllllIIIlllIlllIl();for lIlIlllIIIlIIIIlIII=1,lIllIlIllIlllll()do local IlllIIlI=IlIllIIllllIIIlllIlllIl();if(IlIIIlIllIl(IlllIIlI,1,1)==0)then local IIlIlIlIllllIIlIlI=IlIIIlIllIl(IlllIIlI,2,3);local lllIlIllIIIIllIllIlIll=IlIIIlIllIl(IlllIIlI,4,6);local IlllIIlI={IlllIIIIIIlIIIll(),IlllIIIIIIlIIIll(),nil,nil};if(IIlIlIlIllllIIlIlI==0)then IlllIIlI[#("jMz")]=IlllIIIIIIlIIIll();IlllIIlI[#("0K0d")]=IlllIIIIIIlIIIll();elseif(IIlIlIlIllllIIlIlI==1)then IlllIIlI[#("7Ti")]=lIllIlIllIlllll();elseif(IIlIlIlIllllIIlIlI==2)then IlllIIlI[#("7p8")]=lIllIlIllIlllll()-(2^16)elseif(IIlIlIlIllllIIlIlI==3)then IlllIIlI[#("gGK")]=lIllIlIllIlllll()-(2^16)IlllIIlI[#("3Yof")]=IlllIIIIIIlIIIll();end;if(IlIIIlIllIl(lllIlIllIIIIllIllIlIll,1,1)==1)then IlllIIlI[#("IK")]=IIlllIlIllIIllIl[IlllIIlI[#("JH")]]end if(IlIIIlIllIl(lllIlIllIIIIllIllIlIll,2,2)==1)then IlllIIlI[#("5A3")]=IIlllIlIllIIllIl[IlllIIlI[#("9ZX")]]end if(IlIIIlIllIl(lllIlIllIIIIllIllIlIll,3,3)==1)then IlllIIlI[#("U6L7")]=IIlllIlIllIIllIl[IlllIIlI[#{{736;318;344;470};"1 + 1 = 111";{321;173;458;32};{754;688;818;488};}]]end llIIlllIlIlIIIIlI[lIlIlllIIIlIIIIlIII]=IlllIIlI;end end;return lIlIlllIIIlIIIIlIII;end;local IlIIlIIIl=pcall local function IIIIlllll(IlIllIIllllIIIlllIlllIl,lIlIlllIIIlIIIIlIII,IIlllIlIllIIllIl)IlIllIIllllIIIlllIlllIl=(IlIllIIllllIIIlllIlllIl==true and lllIIlllIIIlllI())or IlIllIIllllIIIlllIlllIl;return(function(...)local lIllIlIllIlllll=1;local IlllIIlI=-1;local IlIllllIlIIIIlllllIIIl={...};local lIlIlIlIlllIIllIIIIlI=llIIlllIlIlIIIIlI('#',...)-1;local IIlIlIlIllllIIlIlI=IlIllIIllllIIIlllIlllIl[#{{751;258;442;124};}];local IlllIIIIIIlIIIll=IlIllIIllllIIIlllIlllIl[#{{54;896;211;544};{291;296;96;370};{562;922;775;19};}];local lllIIlllIIIlllI=IlIllIIllllIIIlllIlllIl[#{"1 + 1 = 111";{213;929;151;484};}];local function lIlIlIllIlIlIll()local IlllIIlI=IIlllIIllIIllllIIlIIl local IlIllIIllllIIIlllIlllIl={};local llIIlllIlIlIIIIlI={};local IlIIIlIllIl={};for IlllIIlI=0,lIlIlIlIlllIIllIIIIlI do if(IlllIIlI>=IlllIIIIIIlIIIll)then IlIllIIllllIIIlllIlllIl[IlllIIlI-IlllIIIIIIlIIIll]=IlIllllIlIIIIlllllIIIl[IlllIIlI+1];else IlIIIlIllIl[IlllIIlI]=IlIllllIlIIIIlllllIIIl[IlllIIlI+1];end;end;local IlllIIlI=lIlIlIlIlllIIllIIIIlI-IlllIIIIIIlIIIll+1 local IlllIIlI;local IlllIIIIIIlIIIll;while true do IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("S")];if IlllIIIIIIlIIIll<=#("lhhr2l9oVeLcXgouWQrP9Cq")then if IlllIIIIIIlIIIll<=#("0VFD0Y8Ul9N")then if IlllIIIIIIlIIIll<=#("2Lcsc")then if IlllIIIIIIlIIIll<=#("ma")then if IlllIIIIIIlIIIll<=#("")then IlIIIlIllIl[IlllIIlI[#("Y7")]][IlllIIlI[#("1Lt")]]=IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{889;158;557;252};}]];elseif IlllIIIIIIlIIIll>#("C")then if(IlIIIlIllIl[IlllIIlI[#("Bf")]]~=IlllIIlI[#("pA6A")])then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("GIk")];end;else IlIIIlIllIl[IlllIIlI[#("yt")]]=IlllIIlI[#("nvE")];end;elseif IlllIIIIIIlIIIll<=#("H6R")then IlIIIlIllIl[IlllIIlI[#("RI")]]=(not IlIIIlIllIl[IlllIIlI[#("SgC")]]);elseif IlllIIIIIIlIIIll==#("1fPU")then local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("Au")]]=IIlllIlIllIIllIl[IlllIIlI[#{{805;881;791;479};{745;625;592;468};"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("4U")]]=IlIIIlIllIl[IlllIIlI[#("zpO")]][IlllIIlI[#("QNQ1")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("6g")]]=IlllIIlI[#("4PD")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("HR")]]=IlllIIlI[#("ZGJ")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("oX")]]=IlllIIlI[#("YCW")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Ne")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("zZ1")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("V1")]][IlllIIlI[#("eWK")]]=IlIIIlIllIl[IlllIIlI[#("ZUvX")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("1z")]][IlllIIlI[#("b5d")]]=IlllIIlI[#("NOls")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("dH")]][IlllIIlI[#("8XD")]]=IlllIIlI[#("7KGM")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("2E")]][IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]]=IlllIIlI[#("PcoE")];else if(IlIIIlIllIl[IlllIIlI[#("7b")]]==IlIIIlIllIl[IlllIIlI[#("Sm9n")]])then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("7by")];end;end;elseif IlllIIIIIIlIIIll<=#("PBgRGy7f")then if IlllIIIIIIlIIIll<=#("0YDyDk")then IlIIIlIllIl[IlllIIlI[#("J5")]]=IlllIIlI[#("fzy")];elseif IlllIIIIIIlIIIll==#("9Mkpq3K")then local IIlIlIlIllllIIlIlI=IlllIIlI[#("EO")];local lIllIlIllIlllll=IlIIIlIllIl[IlllIIlI[#("Xj0")]];IlIIIlIllIl[IIlIlIlIllllIIlIlI+1]=lIllIlIllIlllll;IlIIIlIllIl[IIlIlIlIllllIIlIlI]=lIllIlIllIlllll[IlllIIlI[#("D1Z4")]];else local IIlllIlIllIIllIl;local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("UN")]]=IlIIIlIllIl[IlllIIlI[#("ufR")]][IlllIIlI[#("hqU8")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Pq")];IIlllIlIllIIllIl=IlIIIlIllIl[IlllIIlI[#("c1A")]];IlIIIlIllIl[IlllIIIIIIlIIIll+1]=IIlllIlIllIIllIl;IlIIIlIllIl[IlllIIIIIIlIIIll]=IIlllIlIllIIllIl[IlllIIlI[#("7dqB")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Cl")]]=IlllIIlI[#("P3q")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("EU")]]={};lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("a5")]][IlllIIlI[#("LOX")]]=IlllIIlI[#("S6eR")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("QI")]][IlllIIlI[#{{58;36;813;545};"1 + 1 = 111";{510;830;562;667};}]]=IlllIIlI[#("P4uS")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("n0")]][IlllIIlI[#("5kz")]]=IlllIIlI[#("NylB")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Id")]IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("B9t")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];lIllIlIllIlllll=IlllIIlI[#("z27")];end;elseif IlllIIIIIIlIIIll<=#("W63hK3gt3")then local IlllIIlI=IlllIIlI[#("lK")]IlIIIlIllIl[IlllIIlI]=IlIIIlIllIl[IlllIIlI](IlIIIlIllIl[IlllIIlI+1])elseif IlllIIIIIIlIIIll>#("nk5LHBp4TA")then local llIIlllIlIlIIIIlI;local IlIllIIllllIIIlllIlllIl;local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("nP")]]=IlIIIlIllIl[IlllIIlI[#("fXE")]][IlllIIlI[#("NUig")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Pj")]]=IlIIIlIllIl[IlllIIlI[#("gMd")]][IlllIIlI[#("VYrT")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("hb")]]=IlIIIlIllIl[IlllIIlI[#("436")]][IlllIIlI[#{{895;815;559;905};{11;356;852;924};"1 + 1 = 111";"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Jl")]]=IlIIIlIllIl[IlllIIlI[#{{323;548;724;229};"1 + 1 = 111";"1 + 1 = 111";}]][IlllIIlI[#("MWXf")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("CM")]]=IIlllIlIllIIllIl[IlllIIlI[#("MuP")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Jy")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("xuu")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("l7")]]=IlIIIlIllIl[IlllIIlI[#("RtA")]][IlllIIlI[#("Wisu")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#{{169;154;728;930};{192;419;483;985};}]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("0p")]][IlllIIlI[#{"1 + 1 = 111";{129;15;554;844};"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Nl")]]=IIlllIlIllIIllIl[IlllIIlI[#("6y3")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("XD")]]=IlIIIlIllIl[IlllIIlI[#("j36")]][IlllIIlI[#("TetS")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Jn")];IlIllIIllllIIIlllIlllIl=IlIIIlIllIl[IlllIIlI[#("AfL")]];IlIIIlIllIl[IlllIIIIIIlIIIll+1]=IlIllIIllllIIIlllIlllIl;IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIllIIllllIIIlllIlllIl[IlllIIlI[#("m4jO")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("AZ")]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Z2")]]={};lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Dh")]][IlllIIlI[#{{866;472;388;56};{571;217;203;472};{602;237;570;422};}]]=IlllIIlI[#("4PvP")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("XV")]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("19")]]=IIlllIlIllIIllIl[IlllIIlI[#("Ctl")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("3a")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("laj")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("LE")]]=IlIIIlIllIl[IlllIIlI[#("Ojg")]][IlllIIlI[#("Zx58")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("FY")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIllIIllllIIIlllIlllIl=IlllIIlI[#("FDr")];llIIlllIlIlIIIIlI=IlIIIlIllIl[IlIllIIllllIIIlllIlllIl]for IlllIIlI=IlIllIIllllIIIlllIlllIl+1,IlllIIlI[#("1KfT")]do llIIlllIlIlIIIIlI=llIIlllIlIlIIIIlI..IlIIIlIllIl[IlllIIlI];end;IlIIIlIllIl[IlllIIlI[#("ME")]]=llIIlllIlIlIIIIlI;lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("OW")]][IlllIIlI[#("zo4")]]=IlIIIlIllIl[IlllIIlI[#("ECYg")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("B2")]][IlllIIlI[#("Ut6")]]=IlllIIlI[#("nR3W")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Zi")]IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("Qyt")]))else local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("iv")]][IlllIIlI[#("RlK")]]=IlllIIlI[#("MHZ0")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IIlllIlIllIIllIl[IlllIIlI[#("3ju")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("ac")]]=IlIIIlIllIl[IlllIIlI[#("Rjo")]][IlllIIlI[#("RMjD")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("KV")]]=IlllIIlI[#("6Bx")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("33")]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("e8")]]=IlllIIlI[#("LuO")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("U4")]]=IlllIIlI[#("Sn9")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#{{455;682;664;609};"1 + 1 = 111";}]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("yZf")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("eY")]][IlllIIlI[#("RED")]]=IlIIIlIllIl[IlllIIlI[#("gXNi")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Nx")]]=IIlllIlIllIIllIl[IlllIIlI[#("JXE")]];end;elseif IlllIIIIIIlIIIll<=#("oiEHU2DFEKW1X4KFZ")then if IlllIIIIIIlIIIll<=#("7UFJzoaTyfUavj")then if IlllIIIIIIlIIIll<=#("QHXAL0bOZAAC")then local lIllIlIllIlllll=IlllIIlI[#("0c")];local IIlIlIlIllllIIlIlI=IlIIIlIllIl[IlllIIlI[#("iCb")]];IlIIIlIllIl[lIllIlIllIlllll+1]=IIlIlIlIllllIIlIlI;IlIIIlIllIl[lIllIlIllIlllll]=IIlIlIlIllllIIlIlI[IlllIIlI[#("mMjE")]];elseif IlllIIIIIIlIIIll>#("hR66AAVQjQUoG")then if(IlIIIlIllIl[IlllIIlI[#("gU")]]==IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{921;696;117;737};"1 + 1 = 111";"1 + 1 = 111";}]])then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("9Gv")];end;else local lIllIlIllIlllll=IlllIIlI[#("HA")]IlIIIlIllIl[lIllIlIllIlllll]=IlIIIlIllIl[lIllIlIllIlllll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,lIllIlIllIlllll+1,IlllIIlI[#("71i")]))end;elseif IlllIIIIIIlIIIll<=#{"1 + 1 = 111";"1 + 1 = 111";{585;230;457;601};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{567;979;341;22};"1 + 1 = 111";"1 + 1 = 111";{876;510;68;15};{240;130;457;249};"1 + 1 = 111";"1 + 1 = 111";{758;728;75;862};{209;839;703;538};}then local lIllIlIllIlllll=IlllIIlI[#("9F")]IlIIIlIllIl[lIllIlIllIlllll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,lIllIlIllIlllll+1,IlllIIlI[#("0de")]))elseif IlllIIIIIIlIIIll>#("i8XRLRjYL6zEH1dl")then local IlIllIIllllIIIlllIlllIl=lllIIlllIIIlllI[IlllIIlI[#("ILL")]];local lllIlIllIIIIllIllIlIll;local IlllIIIIIIlIIIll={};lllIlIllIIIIllIllIlIll=llIIIIIlIIIIIlII({},{__index=function(lIllIlIllIlllll,IlllIIlI)local IlllIIlI=IlllIIIIIIlIIIll[IlllIIlI];return IlllIIlI[1][IlllIIlI[2]];end,__newindex=function(IlIIIlIllIl,IlllIIlI,lIllIlIllIlllll)local IlllIIlI=IlllIIIIIIlIIIll[IlllIIlI]IlllIIlI[1][IlllIIlI[2]]=lIllIlIllIlllll;end;});for IIlllIlIllIIllIl=1,IlllIIlI[#{{829;266;805;719};{191;386;959;619};{228;190;358;671};"1 + 1 = 111";}]do lIllIlIllIlllll=lIllIlIllIlllll+1;local IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];if IlllIIlI[#("n")]==40 then IlllIIIIIIlIIIll[IIlllIlIllIIllIl-1]={IlIIIlIllIl,IlllIIlI[#("jmC")]};else IlllIIIIIIlIIIll[IIlllIlIllIIllIl-1]={lIlIlllIIIlIIIIlIII,IlllIIlI[#("dBR")]};end;llIIlllIlIlIIIIlI[#llIIlllIlIlIIIIlI+1]=IlllIIIIIIlIIIll;end;IlIIIlIllIl[IlllIIlI[#("zc")]]=IIIIlllll(IlIllIIllllIIIlllIlllIl,lllIlIllIIIIllIllIlIll,IIlllIlIllIIllIl);else local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("NV")]][IlllIIlI[#("74G")]]=IlllIIlI[#("mVJv")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("qv")]][IlllIIlI[#("Xlh")]]=IlllIIlI[#("sIeB")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Oe")]][IlllIIlI[#("sy9")]]=IlllIIlI[#("oAN4")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("JC")]][IlllIIlI[#("2Qk")]]=IlIIIlIllIl[IlllIIlI[#("RYQ5")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Rg")]]=IIlllIlIllIIllIl[IlllIIlI[#("RQ7")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Bx")]]=IlIIIlIllIl[IlllIIlI[#("Ag4")]][IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{289;964;117;926};}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("LT")]]=IlllIIlI[#("lYm")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("vX")]]=IlllIIlI[#("9im")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("XI")]]=IlllIIlI[#("Y3x")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("GV")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#{"1 + 1 = 111";{562;906;747;126};"1 + 1 = 111";}]))end;elseif IlllIIIIIIlIIIll<=#{{526;797;274;480};"1 + 1 = 111";"1 + 1 = 111";{261;85;669;886};{446;397;958;364};"1 + 1 = 111";{311;15;198;746};"1 + 1 = 111";{281;889;268;751};"1 + 1 = 111";"1 + 1 = 111";{856;449;838;970};"1 + 1 = 111";{427;361;535;773};{978;563;164;422};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{556;691;46;522};"1 + 1 = 111";}then if IlllIIIIIIlIIIll<=#("AXm72rnnLGT2kYAZLm")then local lIlIlllIIIlIIIIlIII;local IlllIIIIIIlIIIll;IlllIIIIIIlIIIll=IlllIIlI[#("nr")]IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("55d")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("PC")]]=IIlllIlIllIIllIl[IlllIIlI[#("LzX")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("b5k")]][IlllIIlI[#("N6LV")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{{941;425;593;48};"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("Ddb")]][IlllIIlI[#("MJUd")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("MH")]]=IIlllIlIllIIllIl[IlllIIlI[#("9Hp")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("G0")];lIlIlllIIIlIIIIlIII=IlIIIlIllIl[IlllIIlI[#("8mj")]];IlIIIlIllIl[IlllIIIIIIlIIIll+1]=lIlIlllIIIlIIIIlIII;IlIIIlIllIl[IlllIIIIIIlIIIll]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("vnrJ")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("WI")]]=IlllIIlI[#("kCy")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("fY")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("thk")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("9q")]]=IIlllIlIllIIllIl[IlllIIlI[#("csS")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("UD")];lIlIlllIIIlIIIIlIII=IlIIIlIllIl[IlllIIlI[#("dUx")]];IlIIIlIllIl[IlllIIIIIIlIIIll+1]=lIlIlllIIIlIIIIlIII;IlIIIlIllIl[IlllIIIIIIlIIIll]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("OITr")]];elseif IlllIIIIIIlIIIll>#("7gLx96BlK4ctrUpATdh")then IlIIIlIllIl[IlllIIlI[#("uh")]]={};else IlIIIlIllIl[IlllIIlI[#("Yu")]]=IIlllIlIllIIllIl[IlllIIlI[#("aT4")]];end;elseif IlllIIIIIIlIIIll<=#{{522;699;757;45};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{947;564;283;336};"1 + 1 = 111";{747;531;660;953};{639;965;748;56};{778;857;738;968};"1 + 1 = 111";{329;124;855;234};{576;465;333;18};"1 + 1 = 111";{516;564;488;563};"1 + 1 = 111";{716;912;464;212};{90;383;994;22};"1 + 1 = 111";"1 + 1 = 111";{737;848;335;822};"1 + 1 = 111";}then if(IlIIIlIllIl[IlllIIlI[#("8b")]]~=IlllIIlI[#("TvQ0")])then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#{{263;317;695;117};{97;220;726;165};{179;668;826;63};}];end;elseif IlllIIIIIIlIIIll==#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{344;824;556;472};"1 + 1 = 111";{816;396;821;145};{375;270;818;905};"1 + 1 = 111";"1 + 1 = 111";{126;446;26;216};"1 + 1 = 111";{614;24;359;144};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{113;83;670;837};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}then do return end;else local lIllIlIllIlllll=IlllIIlI[#("y8")]IlIIIlIllIl[lIllIlIllIlllll]=IlIIIlIllIl[lIllIlIllIlllll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,lIllIlIllIlllll+1,IlllIIlI[#("2Gd")]))end;elseif IlllIIIIIIlIIIll<=#("k9spHLs0gMY9c1M9ZeIT8zlgi8N2Pda1Cjy")then if IlllIIIIIIlIIIll<=#("i3yXy5yGdvRt6JhxQClVXmgJ7BkcL")then if IlllIIIIIIlIIIll<=#("H3EA06QVvdbPcWrt6g6Ok97Mz5")then if IlllIIIIIIlIIIll<=#("ZZ6Uu5gZX0GSkQ5ghUhkurOF")then local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#{{877;639;755;21};"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("CPQ")]][IlllIIlI[#("6Ahy")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("UT")]][IlllIIlI[#("V39")]]=IlIIIlIllIl[IlllIIlI[#("Pv1l")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("0r")]][IlllIIlI[#("bZj")]]=IlllIIlI[#("x6sO")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("pU")]][IlllIIlI[#("Ulu")]]=IlllIIlI[#("PQJt")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("rh")]]=IIlllIlIllIIllIl[IlllIIlI[#("uGX")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("2Q")]]=IlIIIlIllIl[IlllIIlI[#("kD7")]][IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{351;215;84;887};}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("gT")]]=IlllIIlI[#("rfl")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("lO")]]=IlllIIlI[#("xNf")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{{974;601;895;853};{73;508;430;58};}]]=IlllIIlI[#("dxH")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("hH")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("M9T")]))elseif IlllIIIIIIlIIIll==#{{458;550;151;524};{283;801;622;812};{609;77;388;576};"1 + 1 = 111";{62;539;249;305};{843;742;284;780};{486;447;468;826};{76;948;80;373};"1 + 1 = 111";{328;306;295;343};{404;735;983;725};"1 + 1 = 111";"1 + 1 = 111";{515;441;909;53};{982;477;300;62};{549;297;783;880};{242;298;650;526};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{24;955;28;587};{163;254;15;108};"1 + 1 = 111";{959;148;152;701};}then IlIIIlIllIl[IlllIIlI[#("Oy")]]=IlIIIlIllIl[IlllIIlI[#("VmV")]][IlllIIlI[#("eYh2")]];else local IIlIlIlIllllIIlIlI=IlllIIlI[#("Jbt")];local lIllIlIllIlllll=IlIIIlIllIl[IIlIlIlIllllIIlIlI]for IlllIIlI=IIlIlIlIllllIIlIlI+1,IlllIIlI[#("rpUy")]do lIllIlIllIlllll=lIllIlIllIlllll..IlIIIlIllIl[IlllIIlI];end;IlIIIlIllIl[IlllIIlI[#("gA")]]=lIllIlIllIlllll;end;elseif IlllIIIIIIlIIIll<=#("2rVCIlCQp8ur28GXaZ8RZexpxXk")then if not IlIIIlIllIl[IlllIIlI[#("Wp")]]then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("E4A")];end;elseif IlllIIIIIIlIIIll>#{{755;883;137;288};"1 + 1 = 111";{447;227;516;579};"1 + 1 = 111";"1 + 1 = 111";{123;331;636;34};{922;998;788;715};{898;868;495;283};"1 + 1 = 111";{59;461;744;542};"1 + 1 = 111";{462;634;341;827};{661;9;485;829};"1 + 1 = 111";"1 + 1 = 111";{579;257;514;603};"1 + 1 = 111";{890;644;525;969};"1 + 1 = 111";"1 + 1 = 111";{409;443;939;268};"1 + 1 = 111";{346;980;155;387};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{311;457;126;594};{503;405;286;533};}then local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("R3")]]=IIlllIlIllIIllIl[IlllIIlI[#("TZO")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("gf")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("RBB")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("fG")]]=IlIIIlIllIl[IlllIIlI[#("RNX")]][IlllIIlI[#("lBvq")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Rg")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Er")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("TxZ")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("iE")]]=IlIIIlIllIl[IlllIIlI[#("O7I")]][IlllIIlI[#("9xfM")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];if(IlIIIlIllIl[IlllIIlI[#("Ce")]]~=IlllIIlI[#("RofR")])then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("XNE")];end;else do return end;end;elseif IlllIIIIIIlIIIll<=#("GfUax959YOW9WOrGnVlOLOQlPlgIZpCe")then if IlllIIIIIIlIIIll<=#("ZONIUJNFXXc0Gh6DNcBZjt1zJvl3xj")then IlIIIlIllIl[IlllIIlI[#("eS")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("SWQ")]];elseif IlllIIIIIIlIIIll>#("lRX7aO7ElJjX1OvjdjemmapcGWo9yxT")then IlIIIlIllIl[IlllIIlI[#("3L")]][IlllIIlI[#("Vz1")]]=IlllIIlI[#("cWvY")];else local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("Ol")]]=IlllIIlI[#("mUe")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("rf")]]=IlllIIlI[#("TJQ")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Oz")]]=IlllIIlI[#("IcD")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Rf")]]=IlllIIlI[#("AxD")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("SK")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("l5j")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("8B")]][IlllIIlI[#("vfJ")]]=IlIIIlIllIl[IlllIIlI[#("zsea")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Dk")]]=IIlllIlIllIIllIl[IlllIIlI[#{"1 + 1 = 111";{216;360;19;491};"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{897;565;986;899};}]]=IlIIIlIllIl[IlllIIlI[#("Vk4")]][IlllIIlI[#("1o8V")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("nu")]]=IlIIIlIllIl[IlllIIlI[#("Wul")]][IlllIIlI[#("gm5X")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("MN")]][IlllIIlI[#("rKP")]]=IlIIIlIllIl[IlllIIlI[#("otsy")]];end;elseif IlllIIIIIIlIIIll<=#("No0iSk6YPJop9G9UnliUr7ulBUBnA8fYZ")then local IIlIlIlIllllIIlIlI=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{485;941;76;686};}];local lIllIlIllIlllll=IlIIIlIllIl[IIlIlIlIllllIIlIlI]for IlllIIlI=IIlIlIlIllllIIlIlI+1,IlllIIlI[#{{603;859;346;497};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]do lIllIlIllIlllll=lIllIlIllIlllll..IlIIIlIllIl[IlllIIlI];end;IlIIIlIllIl[IlllIIlI[#("An")]]=lIllIlIllIlllll;elseif IlllIIIIIIlIIIll==#{"1 + 1 = 111";"1 + 1 = 111";{286;832;418;566};"1 + 1 = 111";"1 + 1 = 111";{679;144;122;892};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{87;52;947;123};{424;970;962;896};{168;182;635;898};{359;505;698;790};{582;450;51;613};"1 + 1 = 111";{797;632;833;675};"1 + 1 = 111";"1 + 1 = 111";{625;186;516;31};{372;937;183;246};{615;732;849;682};{158;598;126;792};"1 + 1 = 111";{407;726;467;745};{846;728;709;477};{443;941;113;874};{212;584;406;753};"1 + 1 = 111";{431;239;991;44};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";{602;811;161;433};}then local IlllIIlI=IlllIIlI[#("aC")]IlIIIlIllIl[IlllIIlI]=IlIIIlIllIl[IlllIIlI](IlIIIlIllIl[IlllIIlI+1])else IlIIIlIllIl[IlllIIlI[#("GA")]]={};end;elseif IlllIIIIIIlIIIll<=#("x6aUoGbAQzBSBB5m3K0mFSjGEkF10lvKfOAIVCaDX")then if IlllIIIIIIlIIIll<=#("npqprrDEK0KV1PXFqebkJFc0MXbyBBJxAoE3on")then if IlllIIIIIIlIIIll<=#("myvLG9uXUUql6BNQTmANEqedjqnuMk4pclZW")then local IlIllIIllllIIIlllIlllIl=lllIIlllIIIlllI[IlllIIlI[#("jvI")]];local lllIlIllIIIIllIllIlIll;local IlllIIIIIIlIIIll={};lllIlIllIIIIllIllIlIll=llIIIIIlIIIIIlII({},{__index=function(lIllIlIllIlllll,IlllIIlI)local IlllIIlI=IlllIIIIIIlIIIll[IlllIIlI];return IlllIIlI[1][IlllIIlI[2]];end,__newindex=function(IlIIIlIllIl,IlllIIlI,lIllIlIllIlllll)local IlllIIlI=IlllIIIIIIlIIIll[IlllIIlI]IlllIIlI[1][IlllIIlI[2]]=lIllIlIllIlllll;end;});for IIlllIlIllIIllIl=1,IlllIIlI[#("0TBS")]do lIllIlIllIlllll=lIllIlIllIlllll+1;local IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];if IlllIIlI[#("g")]==40 then IlllIIIIIIlIIIll[IIlllIlIllIIllIl-1]={IlIIIlIllIl,IlllIIlI[#("sDe")]};else IlllIIIIIIlIIIll[IIlllIlIllIIllIl-1]={lIlIlllIIIlIIIIlIII,IlllIIlI[#("ptg")]};end;llIIlllIlIlIIIIlI[#llIIlllIlIlIIIIlI+1]=IlllIIIIIIlIIIll;end;IlIIIlIllIl[IlllIIlI[#{{447;864;155;989};{160;137;170;768};}]]=IIIIlllll(IlIllIIllllIIIlllIlllIl,lllIlIllIIIIllIllIlIll,IIlllIlIllIIllIl);elseif IlllIIIIIIlIIIll>#("4H0raqNjoN5WJVQZLy6ssCoW9lK0bjUM0DZQJ")then IlIIIlIllIl[IlllIIlI[#("AB")]]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("k84")]];else local lIlIlllIIIlIIIIlIII;local IlllIIIIIIlIIIll;IlIIIlIllIl[IlllIIlI[#("AU")]]=IIlllIlIllIIllIl[IlllIIlI[#{"1 + 1 = 111";{380;893;464;812};"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Nf")]]=IlIIIlIllIl[IlllIIlI[#("hku")]][IlllIIlI[#("G45D")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("tB")]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{890;48;225;719};}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("rt")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Vd")]]=IIlllIlIllIIllIl[IlllIIlI[#("qeq")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("oc")]]=IlIIIlIllIl[IlllIIlI[#("sZ6")]][IlllIIlI[#("3xuI")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Or")]]=IlllIIlI[#("i5M")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("eR")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("8D")]]=IIlllIlIllIIllIl[IlllIIlI[#("fec")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("neY")]][IlllIIlI[#{{911;625;538;645};"1 + 1 = 111";"1 + 1 = 111";{167;168;817;443};}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("l3")]]=IlllIIlI[#("QMX")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("IX")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("S9")]]=IIlllIlIllIIllIl[IlllIIlI[#("5zM")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("4g")]]=IlIIIlIllIl[IlllIIlI[#("aDk")]][IlllIIlI[#("Fssr")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("dT")]]=IlllIIlI[#("HDJ")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("fU")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](IlIIIlIllIl[IlllIIIIIIlIIIll+1])lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("oR")]]=IIlllIlIllIIllIl[IlllIIlI[#("dhY")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("hW")]]=IlIIIlIllIl[IlllIIlI[#("b54")]][IlllIIlI[#("TE7W")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Hv")]]=IlIIIlIllIl[IlllIIlI[#("jir")]][IlllIIlI[#("8YHu")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}];lIlIlllIIIlIIIIlIII=IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{997;46;878;720};{317;477;435;733};}]];IlIIIlIllIl[IlllIIIIIIlIIIll+1]=lIlIlllIIIlIIIIlIII;IlIIIlIllIl[IlllIIIIIIlIIIll]=lIlIlllIIIlIIIIlIII[IlllIIlI[#("hXqx")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("p2")]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{11;585;152;297};}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("ff")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("qVd")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Rm")]][IlllIIlI[#("n88")]]=IlIIIlIllIl[IlllIIlI[#("mqCu")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("kH")]]=IIlllIlIllIIllIl[IlllIIlI[#("UWU")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{425;375;597;229};}]]=IlIIIlIllIl[IlllIIlI[#("F1z")]][IlllIIlI[#("29Vt")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("ea")]]=IlIIIlIllIl[IlllIIlI[#("qDr")]][IlllIIlI[#("RgHj")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("a3")]][IlllIIlI[#("RAu")]]=IlIIIlIllIl[IlllIIlI[#("HBjW")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Qm")]][IlllIIlI[#("gJ0")]]=IlIIIlIllIl[IlllIIlI[#("b6jP")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Ie")]]=IIlllIlIllIIllIl[IlllIIlI[#("Lfk")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("yb")]]=IlIIIlIllIl[IlllIIlI[#("I44")]][IlllIIlI[#("fZ9O")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Ix")]]=IlllIIlI[#("d4h")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("5O")]]=IlllIIlI[#{{842;100;433;976};"1 + 1 = 111";"1 + 1 = 111";}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("38")]]=IlllIIlI[#("yQI")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("Sz")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("EVZ")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("fd")]][IlllIIlI[#("uk8")]]=IlIIIlIllIl[IlllIIlI[#("7h8Z")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("U3")]]=IIlllIlIllIIllIl[IlllIIlI[#("BqX")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{{347;296;152;698};"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("h0e")]][IlllIIlI[#("o07W")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("du")]]=IlllIIlI[#("MZe")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("3K")]]=IlllIIlI[#("7gd")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("dI")]]=IlllIIlI[#("vnY")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlllIIlI[#("W7z")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("YM")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("aKO")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Ss")]][IlllIIlI[#("p8L")]]=IlIIIlIllIl[IlllIIlI[#{{984;454;469;359};{974;717;714;804};"1 + 1 = 111";"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{{256;845;658;298};"1 + 1 = 111";}]]=IIlllIlIllIIllIl[IlllIIlI[#("6c1")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#("gD5")]][IlllIIlI[#("1rxk")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("lK")]]=IlllIIlI[#{"1 + 1 = 111";{665;662;331;360};{711;965;854;249};}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("QX")]]=IlllIIlI[#("L6s")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("fz")]]=IlllIIlI[#("SE0")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("gF")]]=IlllIIlI[#("vHe")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#{"1 + 1 = 111";{928;803;800;3};}]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("1xO")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{31;969;306;703};}]][IlllIIlI[#("mnz")]]=IlIIIlIllIl[IlllIIlI[#("ROFR")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("NA")]][IlllIIlI[#("nSP")]]=IlllIIlI[#("pgX1")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IlllIIlI[#("pqo")]]=IlllIIlI[#("c9gx")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("9c")]][IlllIIlI[#("rSp")]]=IlIIIlIllIl[IlllIIlI[#("KiR7")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("6b")]]=IIlllIlIllIIllIl[IlllIIlI[#("k0Z")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("tT")]]=IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IlllIIlI[#("QDxS")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{518;415;923;323};}]]=IlllIIlI[#("hFb")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Hy")]]=IlllIIlI[#("8y5")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Zm")]]=IlllIIlI[#("Yy3")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("NS")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("Kiu")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("ih")]][IlllIIlI[#("ryh")]]=IlIIIlIllIl[IlllIIlI[#("ssPI")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("bz")]][IlllIIlI[#("o7Y")]]=IlllIIlI[#("XCZs")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("LS")]]=IIlllIlIllIIllIl[IlllIIlI[#("qqs")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("AZ")]]=IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]][IlllIIlI[#("tMqS")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("SQ")]]=IlllIIlI[#("gMG")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("Ki")]]=IlllIIlI[#("Qp6")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("sW")]]=IlllIIlI[#("vGd")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("9u")]]=IlllIIlI[#("Zsn")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("eb")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#{"1 + 1 = 111";{175;2;262;510};{704;641;284;982};}]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("QX")]][IlllIIlI[#("iQI")]]=IlIIIlIllIl[IlllIIlI[#("hdgv")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("jT")]]=IIlllIlIllIIllIl[IlllIIlI[#("Qyi")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("s1")]]=IlIIIlIllIl[IlllIIlI[#("f4l")]][IlllIIlI[#{{749;965;119;950};"1 + 1 = 111";"1 + 1 = 111";"1 + 1 = 111";}]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("t4")]]=IlllIIlI[#("h70")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("4S")]]=IlllIIlI[#("NLm")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";{946;612;850;708};}]]=IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";{220;34;709;374};}];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("QZ")]]=IlllIIlI[#("43Y")];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlllIIIIIIlIIIll=IlllIIlI[#("9p")]IlIIIlIllIl[IlllIIIIIIlIIIll]=IlIIIlIllIl[IlllIIIIIIlIIIll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,IlllIIIIIIlIIIll+1,IlllIIlI[#("cpF")]))lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#{"1 + 1 = 111";"1 + 1 = 111";}]][IlllIIlI[#("YyX")]]=IlIIIlIllIl[IlllIIlI[#("TKAo")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("vi")]]=IIlllIlIllIIllIl[IlllIIlI[#("evc")]];lIllIlIllIlllll=lIllIlIllIlllll+1;IlllIIlI=IIlIlIlIllllIIlIlI[lIllIlIllIlllll];IlIIIlIllIl[IlllIIlI[#("77")]]=IlIIIlIllIl[IlllIIlI[#("hpW")]][IlllIIlI[#("nqWV")]];end;elseif IlllIIIIIIlIIIll<=#("E9C34NrJcznACX2D4CresYQXif3t6g6aqp461zH")then IlIIIlIllIl[IlllIIlI[#("54")]]=IIlllIlIllIIllIl[IlllIIlI[#("tZX")]];elseif IlllIIIIIIlIIIll==#("FBikNLS6TyIxyFcQsOVZU8M5Dnil36LF5QJ2PFjH")then IlIIIlIllIl[IlllIIlI[#("Oq")]]=IlIIIlIllIl[IlllIIlI[#("CpA")]];else lIllIlIllIlllll=IlllIIlI[#("UUC")];end;elseif IlllIIIIIIlIIIll<=#("6KJIKMWnnNmOS1GYmSzCGdXWcCS5jaXEnCXydy3Lx8Ps")then if IlllIIIIIIlIIIll<=#("1mYdeCXVe13XXFi31dnZTApdhUZZXfIyEylo31fIaT")then if not IlIIIlIllIl[IlllIIlI[#("Uz")]]then lIllIlIllIlllll=lIllIlIllIlllll+1;else lIllIlIllIlllll=IlllIIlI[#("LZp")];end;elseif IlllIIIIIIlIIIll>#("L4Lq2VSF4CDPB6U5tN879sFszt3a98QZ9rPjHE7dfKN")then lIllIlIllIlllll=IlllIIlI[#("JkO")];else IlIIIlIllIl[IlllIIlI[#("Zp")]]=(not IlIIIlIllIl[IlllIIlI[#("ALA")]]);end;elseif IlllIIIIIIlIIIll<=#("bSUrj6V5bWjrAr1I1SG5VNQjrLzZP41zQJrQJM0dnVXmhx")then if IlllIIIIIIlIIIll>#("oMzmyeRkycL9IH5pg5UM0al9p1CSaZEb51knqSDu8y3O7")then IlIIIlIllIl[IlllIIlI[#("Uy")]]=IlIIIlIllIl[IlllIIlI[#("kB3")]][IlllIIlI[#("7Cpo")]];else IlIIIlIllIl[IlllIIlI[#{{992;140;605;887};{186;163;120;705};}]][IlllIIlI[#("I34")]]=IlllIIlI[#("KjXh")];end;elseif IlllIIIIIIlIIIll>#("rHrFQqxU3nBz7HM9jIIJeRxS8zDAODhHbNJ5BFinPk77W1V")then local lIllIlIllIlllll=IlllIIlI[#("Bz")]IlIIIlIllIl[lIllIlIllIlllll](lllIlIllIIIIllIllIlIll(IlIIIlIllIl,lIllIlIllIlllll+1,IlllIIlI[#("DOA")]))else IlIIIlIllIl[IlllIIlI[#("TQ")]][IlllIIlI[#{{356;933;609;691};{655;270;867;143};"1 + 1 = 111";}]]=IlIIIlIllIl[IlllIIlI[#{{828;985;526;863};{364;121;968;225};{17;903;96;437};{509;133;278;135};}]];end;lIllIlIllIlllll=lIllIlIllIlllll+1;end;end;A,B=IIlllIIllIIllllIIlIIl(IlIIlIIIl(lIlIlIllIlIlIll))if not A[1]then local IlllIIlI=IlIllIIllllIIIlllIlllIl[4][lIllIlIllIlllll]or'?';error('ERROR IN IRONBREW SCRIPT [LINE '..IlllIIlI..']:'..A[2]);wait(9e9);else return lllIlIllIIIIllIllIlIll(A,2,B);end;end);end;return IIIIlllll(true,{},lIllllllIIIIIIIlll())();end)(string.byte,table.insert,setmetatable);
close fullscreen
Login or Register to edit or fork this paste. It's free.